C18H12F4N2O — CID 86970978
N-[2,2,2-trifluoro-1-(4-fluorophenyl)ethyl]quinoline-6-carboxamide (PubChem CID 86970978) has the molecular formula C18H12F4N2O and a molecular weight of 348.30 g/mol. Its IUPAC name is N-[2,2,2-trifluoro-1-(4-fluorophenyl)ethyl]quinoline-6-carboxamide.
| Compound Name | N-[2,2,2-trifluoro-1-(4-fluorophenyl)ethyl]quinoline-6-carboxamide |
|---|---|
| PubChem CID | 86970978 |
| Molecular Formula | C18H12F4N2O |
| Molecular Weight | 348.30 g/mol |
| Exact Mass | 348.09 |
| IUPAC Name | N-[2,2,2-trifluoro-1-(4-fluorophenyl)ethyl]quinoline-6-carboxamide |
| SMILES | O=C(NC(c1ccc(F)cc1)C(F)(F)F)c1ccc2ncccc2c1 |
| InChI | InChI=1S/C18H12F4N2O/c19-14-6-3-11(4-7-14)16(18(20,21)22)24-17(25)13-5-8-15-12(10-13)2-1-9-23-15/h1-10,16H,(H,24,25) |
| InChIKey | QHLZYFCSMCQGCN-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.30 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |