C18H12N2O2S — CID 711452
N-[2-(1,3-benzothiazol-2-yl)phenyl]furan-2-carboxamide (PubChem CID 711452) has the molecular formula C18H12N2O2S and a molecular weight of 320.37 g/mol. Its IUPAC name is N-[2-(1,3-benzothiazol-2-yl)phenyl]furan-2-carboxamide.
| Compound Name | N-[2-(1,3-benzothiazol-2-yl)phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 711452 |
| Molecular Formula | C18H12N2O2S |
| Molecular Weight | 320.37 g/mol |
| Exact Mass | 320.06 |
| IUPAC Name | N-[2-(1,3-benzothiazol-2-yl)phenyl]furan-2-carboxamide |
| SMILES | O=C(Nc1ccccc1-c1nc2ccccc2s1)c1ccco1 |
| InChI | InChI=1S/C18H12N2O2S/c21-17(15-9-5-11-22-15)19-13-7-2-1-6-12(13)18-20-14-8-3-4-10-16(14)23-18/h1-11H,(H,19,21) |
| InChIKey | KOMGTTCJFZKXIR-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.37 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |