C21H25ClN2O2 — CID 71149847
tert-butyl 4-(4-chlorophenyl)-4-pyridin-4-ylpiperidine-2-carboxylate (PubChem CID 71149847) has the molecular formula C21H25ClN2O2 and a molecular weight of 372.90 g/mol. Its IUPAC name is tert-butyl 4-(4-chlorophenyl)-4-pyridin-4-ylpiperidine-2-carboxylate.
| Compound Name | tert-butyl 4-(4-chlorophenyl)-4-pyridin-4-ylpiperidine-2-carboxylate |
|---|---|
| PubChem CID | 71149847 |
| Molecular Formula | C21H25ClN2O2 |
| Molecular Weight | 372.90 g/mol |
| Exact Mass | 372.16 |
| IUPAC Name | tert-butyl 4-(4-chlorophenyl)-4-pyridin-4-ylpiperidine-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)C1CC(c2ccncc2)(c2ccc(Cl)cc2)CCN1 |
| InChI | InChI=1S/C21H25ClN2O2/c1-20(2,3)26-19(25)18-14-21(10-13-24-18,16-8-11-23-12-9-16)15-4-6-17(22)7-5-15/h4-9,11-12,18,24H,10,13-14H2,1-3H3 |
| InChIKey | SCKRLUBVLIXCSI-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.90 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |