C20H16Cl2N2O2 — CID 71150032
2,6-dichloro-N-[[4-(2-methyl-6-oxo-1H-pyridin-4-yl)phenyl]methyl]benzamide (PubChem CID 71150032) has the molecular formula C20H16Cl2N2O2 and a molecular weight of 387.27 g/mol. Its IUPAC name is 2,6-dichloro-N-[[4-(2-methyl-6-oxo-1H-pyridin-4-yl)phenyl]methyl]benzamide.
| Compound Name | 2,6-dichloro-N-[[4-(2-methyl-6-oxo-1H-pyridin-4-yl)phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 71150032 |
| Molecular Formula | C20H16Cl2N2O2 |
| Molecular Weight | 387.27 g/mol |
| Exact Mass | 386.06 |
| IUPAC Name | 2,6-dichloro-N-[[4-(2-methyl-6-oxo-1H-pyridin-4-yl)phenyl]methyl]benzamide |
| SMILES | Cc1cc(-c2ccc(CNC(=O)c3c(Cl)cccc3Cl)cc2)cc(=O)[nH]1 |
| InChI | InChI=1S/C20H16Cl2N2O2/c1-12-9-15(10-18(25)24-12)14-7-5-13(6-8-14)11-23-20(26)19-16(21)3-2-4-17(19)22/h2-10H,11H2,1H3,(H,23,26)(H,24,25) |
| InChIKey | LWYWZWJVXJWUFS-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.27 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |