C20H18Cl2N2O6P+ — CID 152804425
[[4-[4-[[(2,6-dichlorobenzoyl)amino]methyl]phenyl]-2-oxo-1-pyridinyl]methoxy-hydroxyphosphoryl]oxidanium (PubChem CID 152804425) has the molecular formula C20H18Cl2N2O6P+ and a molecular weight of 484.25 g/mol. Its IUPAC name is [[4-[4-[[(2,6-dichlorobenzoyl)amino]methyl]phenyl]-2-oxo-1-pyridinyl]methoxy-hydroxyphosphoryl]oxidanium.
| Compound Name | [[4-[4-[[(2,6-dichlorobenzoyl)amino]methyl]phenyl]-2-oxo-1-pyridinyl]methoxy-hydroxyphosphoryl]oxidanium |
|---|---|
| PubChem CID | 152804425 |
| Molecular Formula | C20H18Cl2N2O6P+ |
| Molecular Weight | 484.25 g/mol |
| Exact Mass | 483.03 |
| IUPAC Name | [[4-[4-[[(2,6-dichlorobenzoyl)amino]methyl]phenyl]-2-oxo-1-pyridinyl]methoxy-hydroxyphosphoryl]oxidanium |
| SMILES | O=C(NCc1ccc(-c2ccn(COP(=O)(O)[OH2+])c(=O)c2)cc1)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C20H17Cl2N2O6P/c21-16-2-1-3-17(22)19(16)20(26)23-11-13-4-6-14(7-5-13)15-8-9-24(18(25)10-15)12-30-31(27,28)29/h1-10H,11-12H2,(H,23,26)(H2,27,28,29)/p+1 |
| InChIKey | SPADNYVJQZNTKZ-UHFFFAOYSA-O |
| XLogP | 3.55 |
| TPSA | 120.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.25 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|