C25H19ClN4O — CID 97362092
N-[(4-chlorophenyl)methyl]-1-(6-phenylindolizin-3-yl)pyrazole-3-carboxamide (PubChem CID 97362092) has the molecular formula C25H19ClN4O and a molecular weight of 426.91 g/mol. Its IUPAC name is N-[(4-chlorophenyl)methyl]-1-(6-phenylindolizin-3-yl)pyrazole-3-carboxamide.
| Compound Name | N-[(4-chlorophenyl)methyl]-1-(6-phenylindolizin-3-yl)pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 97362092 |
| Molecular Formula | C25H19ClN4O |
| Molecular Weight | 426.91 g/mol |
| Exact Mass | 426.12 |
| IUPAC Name | N-[(4-chlorophenyl)methyl]-1-(6-phenylindolizin-3-yl)pyrazole-3-carboxamide |
| SMILES | O=C(NCc1ccc(Cl)cc1)c1ccn(-c2ccc3ccc(-c4ccccc4)cn23)n1 |
| InChI | InChI=1S/C25H19ClN4O/c26-21-9-6-18(7-10-21)16-27-25(31)23-14-15-30(28-23)24-13-12-22-11-8-20(17-29(22)24)19-4-2-1-3-5-19/h1-15,17H,16H2,(H,27,31) |
| InChIKey | XIDXNWGFPMRELT-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 51.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.91 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |