C22H24N6O — CID 97362124
N-[3-(dimethylamino)propyl]-1-(6-pyridin-4-ylindolizin-3-yl)pyrazole-3-carboxamide (PubChem CID 97362124) has the molecular formula C22H24N6O and a molecular weight of 388.48 g/mol. Its IUPAC name is N-[3-(dimethylamino)propyl]-1-(6-pyridin-4-ylindolizin-3-yl)pyrazole-3-carboxamide.
| Compound Name | N-[3-(dimethylamino)propyl]-1-(6-pyridin-4-ylindolizin-3-yl)pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 97362124 |
| Molecular Formula | C22H24N6O |
| Molecular Weight | 388.48 g/mol |
| Exact Mass | 388.20 |
| IUPAC Name | N-[3-(dimethylamino)propyl]-1-(6-pyridin-4-ylindolizin-3-yl)pyrazole-3-carboxamide |
| SMILES | CN(C)CCCNC(=O)c1ccn(-c2ccc3ccc(-c4ccncc4)cn23)n1 |
| InChI | InChI=1S/C22H24N6O/c1-26(2)14-3-11-24-22(29)20-10-15-28(25-20)21-7-6-19-5-4-18(16-27(19)21)17-8-12-23-13-9-17/h4-10,12-13,15-16H,3,11,14H2,1-2H3,(H,24,29) |
| InChIKey | LBNQSRSUVAMEIP-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 67.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.48 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|