C25H21N5O — CID 97447325
1-(6-phenylindolizin-3-yl)-N-(2-pyridin-3-ylethyl)pyrazole-3-carboxamide (PubChem CID 97447325) has the molecular formula C25H21N5O and a molecular weight of 407.48 g/mol. Its IUPAC name is 1-(6-phenylindolizin-3-yl)-N-(2-pyridin-3-ylethyl)pyrazole-3-carboxamide.
| Compound Name | 1-(6-phenylindolizin-3-yl)-N-(2-pyridin-3-ylethyl)pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 97447325 |
| Molecular Formula | C25H21N5O |
| Molecular Weight | 407.48 g/mol |
| Exact Mass | 407.17 |
| IUPAC Name | 1-(6-phenylindolizin-3-yl)-N-(2-pyridin-3-ylethyl)pyrazole-3-carboxamide |
| SMILES | O=C(NCCc1cccnc1)c1ccn(-c2ccc3ccc(-c4ccccc4)cn23)n1 |
| InChI | InChI=1S/C25H21N5O/c31-25(27-15-12-19-5-4-14-26-17-19)23-13-16-30(28-23)24-11-10-22-9-8-21(18-29(22)24)20-6-2-1-3-7-20/h1-11,13-14,16-18H,12,15H2,(H,27,31) |
| InChIKey | BOZKPDRLWMSLJO-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 64.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.48 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |