C21H22N6O — CID 97447361
N-[2-(dimethylamino)ethyl]-1-(6-pyridin-4-ylindolizin-3-yl)pyrazole-3-carboxamide (PubChem CID 97447361) has the molecular formula C21H22N6O and a molecular weight of 374.45 g/mol. Its IUPAC name is N-[2-(dimethylamino)ethyl]-1-(6-pyridin-4-ylindolizin-3-yl)pyrazole-3-carboxamide.
| Compound Name | N-[2-(dimethylamino)ethyl]-1-(6-pyridin-4-ylindolizin-3-yl)pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 97447361 |
| Molecular Formula | C21H22N6O |
| Molecular Weight | 374.45 g/mol |
| Exact Mass | 374.19 |
| IUPAC Name | N-[2-(dimethylamino)ethyl]-1-(6-pyridin-4-ylindolizin-3-yl)pyrazole-3-carboxamide |
| SMILES | CN(C)CCNC(=O)c1ccn(-c2ccc3ccc(-c4ccncc4)cn23)n1 |
| InChI | InChI=1S/C21H22N6O/c1-25(2)14-12-23-21(28)19-9-13-27(24-19)20-6-5-18-4-3-17(15-26(18)20)16-7-10-22-11-8-16/h3-11,13,15H,12,14H2,1-2H3,(H,23,28) |
| InChIKey | QYGWGGIZASJEON-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 67.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.45 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |