C21H19FN4O2 — CID 97447425
1-[6-(4-fluorophenyl)indolizin-3-yl]-N-(2-methoxyethyl)pyrazole-3-carboxamide (PubChem CID 97447425) has the molecular formula C21H19FN4O2 and a molecular weight of 378.41 g/mol. Its IUPAC name is 1-[6-(4-fluorophenyl)indolizin-3-yl]-N-(2-methoxyethyl)pyrazole-3-carboxamide.
| Compound Name | 1-[6-(4-fluorophenyl)indolizin-3-yl]-N-(2-methoxyethyl)pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 97447425 |
| Molecular Formula | C21H19FN4O2 |
| Molecular Weight | 378.41 g/mol |
| Exact Mass | 378.15 |
| IUPAC Name | 1-[6-(4-fluorophenyl)indolizin-3-yl]-N-(2-methoxyethyl)pyrazole-3-carboxamide |
| SMILES | COCCNC(=O)c1ccn(-c2ccc3ccc(-c4ccc(F)cc4)cn23)n1 |
| InChI | InChI=1S/C21H19FN4O2/c1-28-13-11-23-21(27)19-10-12-26(24-19)20-9-8-18-7-4-16(14-25(18)20)15-2-5-17(22)6-3-15/h2-10,12,14H,11,13H2,1H3,(H,23,27) |
| InChIKey | VOSKMGVUBWBZGK-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 60.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.41 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|