C24H18FN5O2 — CID 97362166
1-[6-(4-fluorophenyl)indolizin-3-yl]-N-(2-methoxy-3-pyridinyl)pyrazole-3-carboxamide (PubChem CID 97362166) has the molecular formula C24H18FN5O2 and a molecular weight of 427.44 g/mol. Its IUPAC name is 1-[6-(4-fluorophenyl)indolizin-3-yl]-N-(2-methoxy-3-pyridinyl)pyrazole-3-carboxamide.
| Compound Name | 1-[6-(4-fluorophenyl)indolizin-3-yl]-N-(2-methoxy-3-pyridinyl)pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 97362166 |
| Molecular Formula | C24H18FN5O2 |
| Molecular Weight | 427.44 g/mol |
| Exact Mass | 427.14 |
| IUPAC Name | 1-[6-(4-fluorophenyl)indolizin-3-yl]-N-(2-methoxy-3-pyridinyl)pyrazole-3-carboxamide |
| SMILES | COc1ncccc1NC(=O)c1ccn(-c2ccc3ccc(-c4ccc(F)cc4)cn23)n1 |
| InChI | InChI=1S/C24H18FN5O2/c1-32-24-21(3-2-13-26-24)27-23(31)20-12-14-30(28-20)22-11-10-19-9-6-17(15-29(19)22)16-4-7-18(25)8-5-16/h2-15H,1H3,(H,27,31) |
| InChIKey | MVISFKSUNIVGFH-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 73.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.44 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |