C23H16FN5O — CID 97447411
1-[6-(3-fluorophenyl)indolizin-3-yl]-N-pyridin-3-ylpyrazole-3-carboxamide (PubChem CID 97447411) has the molecular formula C23H16FN5O and a molecular weight of 397.41 g/mol. Its IUPAC name is 1-[6-(3-fluorophenyl)indolizin-3-yl]-N-pyridin-3-ylpyrazole-3-carboxamide.
| Compound Name | 1-[6-(3-fluorophenyl)indolizin-3-yl]-N-pyridin-3-ylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 97447411 |
| Molecular Formula | C23H16FN5O |
| Molecular Weight | 397.41 g/mol |
| Exact Mass | 397.13 |
| IUPAC Name | 1-[6-(3-fluorophenyl)indolizin-3-yl]-N-pyridin-3-ylpyrazole-3-carboxamide |
| SMILES | O=C(Nc1cccnc1)c1ccn(-c2ccc3ccc(-c4cccc(F)c4)cn23)n1 |
| InChI | InChI=1S/C23H16FN5O/c24-18-4-1-3-16(13-18)17-6-7-20-8-9-22(28(20)15-17)29-12-10-21(27-29)23(30)26-19-5-2-11-25-14-19/h1-15H,(H,26,30) |
| InChIKey | YCHIPBARKISMTM-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 64.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.41 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |