About 4-(2H-benzotriazol-5-yl)-1,2,3-benzothiadiazole
4-(2H-benzotriazol-5-yl)-1,2,3-benzothiadiazole (PubChem CID 71151522) has the molecular formula C12H7N5S
and a molecular weight of 253.29 g/mol. Its IUPAC name is 4-(2H-benzotriazol-5-yl)-1,2,3-benzothiadiazole.
Molecular Properties
| Compound Name | 4-(2H-benzotriazol-5-yl)-1,2,3-benzothiadiazole |
| PubChem CID | 71151522 |
| Molecular Formula | C12H7N5S |
| Molecular Weight | 253.29 g/mol |
| Exact Mass | 253.04 |
| IUPAC Name | 4-(2H-benzotriazol-5-yl)-1,2,3-benzothiadiazole |
| SMILES | c1cc(-c2ccc3n[nH]nc3c2)c2nnsc2c1 |
| InChI | InChI=1S/C12H7N5S/c1-2-8(12-11(3-1)18-17-15-12)7-4-5-9-10(6-7)14-16-13-9/h1-6H,(H,13,14,16) |
| InChIKey | QUJURJSGMSLBRD-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.29 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-(2H-benzotriazol-5-yl)-1,2,3-benzothiadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2H-benzotriazol-5-yl)-1,2,3-benzothiadiazole?
The IUPAC name of 4-(2H-benzotriazol-5-yl)-1,2,3-benzothiadiazole (CID 71151522) is 4-(2H-benzotriazol-5-yl)-1,2,3-benzothiadiazole.
What is the SMILES notation for 4-(2H-benzotriazol-5-yl)-1,2,3-benzothiadiazole?
The canonical SMILES for 4-(2H-benzotriazol-5-yl)-1,2,3-benzothiadiazole is c1cc(-c2ccc3n[nH]nc3c2)c2nnsc2c1.
What is the InChIKey of 4-(2H-benzotriazol-5-yl)-1,2,3-benzothiadiazole?
The InChIKey is QUJURJSGMSLBRD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H7N5S/c1-2-8(12-11(3-1)18-17-15-12)7-4-5-9-10(6-7)14-16-13-9/h1-6H,(H,13,14,16).
What are the key properties of 4-(2H-benzotriazol-5-yl)-1,2,3-benzothiadiazole?
4-(2H-benzotriazol-5-yl)-1,2,3-benzothiadiazole has a molecular weight of 253.29 g/mol, XLogP of 2.63, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2H-benzotriazol-5-yl)-1,2,3-benzothiadiazole is sourced from PubChem (CID 71151522), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).