About 2H-benzotriazole;praseodymium
2H-benzotriazole;praseodymium (PubChem CID 160995657) has the molecular formula C6H5N3Pr
and a molecular weight of 260.04 g/mol. Its IUPAC name is 2H-benzotriazole;praseodymium.
Molecular Properties
| Compound Name | 2H-benzotriazole;praseodymium |
| PubChem CID | 160995657 |
| Molecular Formula | C6H5N3Pr |
| Molecular Weight | 260.04 g/mol |
| Exact Mass | 259.96 |
| IUPAC Name | 2H-benzotriazole;praseodymium |
| SMILES | [Pr].c1ccc2n[nH]nc2c1 |
| InChI | InChI=1S/C6H5N3.Pr/c1-2-4-6-5(3-1)7-9-8-6;/h1-4H,(H,7,8,9); |
| InChIKey | TVFDTOCIEHYKRX-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.04 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2H-benzotriazole;praseodymium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2H-benzotriazole;praseodymium?
The IUPAC name of 2H-benzotriazole;praseodymium (CID 160995657) is 2H-benzotriazole;praseodymium.
What is the SMILES notation for 2H-benzotriazole;praseodymium?
The canonical SMILES for 2H-benzotriazole;praseodymium is [Pr].c1ccc2n[nH]nc2c1.
What is the InChIKey of 2H-benzotriazole;praseodymium?
The InChIKey is TVFDTOCIEHYKRX-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5N3.Pr/c1-2-4-6-5(3-1)7-9-8-6;/h1-4H,(H,7,8,9);.
What are the key properties of 2H-benzotriazole;praseodymium?
2H-benzotriazole;praseodymium has a molecular weight of 260.04 g/mol, XLogP of 0.96, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2H-benzotriazole;praseodymium is sourced from PubChem (CID 160995657), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).