C12H11N3O2 — CID 160549478
benzene-1,4-diol;2H-benzotriazole (PubChem CID 160549478) has the molecular formula C12H11N3O2 and a molecular weight of 229.24 g/mol. Its IUPAC name is benzene-1,4-diol;2H-benzotriazole.
| Compound Name | benzene-1,4-diol;2H-benzotriazole |
|---|---|
| PubChem CID | 160549478 |
| Molecular Formula | C12H11N3O2 |
| Molecular Weight | 229.24 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | benzene-1,4-diol;2H-benzotriazole |
| SMILES | Oc1ccc(O)cc1.c1ccc2n[nH]nc2c1 |
| InChI | InChI=1S/C6H5N3.C6H6O2/c1-2-4-6-5(3-1)7-9-8-6;7-5-1-2-6(8)4-3-5/h1-4H,(H,7,8,9);1-4,7-8H |
| InChIKey | QXWGEDMTICUBQL-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 82.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.24 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|