About 2H-benzotriazole;formaldehyde;phosphoric acid
2H-benzotriazole;formaldehyde;phosphoric acid (PubChem CID 172709237) has the molecular formula C7H10N3O5P
and a molecular weight of 247.15 g/mol. Its IUPAC name is 2H-benzotriazole;formaldehyde;phosphoric acid.
Molecular Properties
| Compound Name | 2H-benzotriazole;formaldehyde;phosphoric acid |
| PubChem CID | 172709237 |
| Molecular Formula | C7H10N3O5P |
| Molecular Weight | 247.15 g/mol |
| Exact Mass | 247.04 |
| IUPAC Name | 2H-benzotriazole;formaldehyde;phosphoric acid |
| SMILES | C=O.O=P(O)(O)O.c1ccc2n[nH]nc2c1 |
| InChI | InChI=1S/C6H5N3.CH2O.H3O4P/c1-2-4-6-5(3-1)7-9-8-6;1-2;1-5(2,3)4/h1-4H,(H,7,8,9);1H2;(H3,1,2,3,4) |
| InChIKey | FAEIIQYNZQRLQF-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 136.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.15 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2H-benzotriazole;formaldehyde;phosphoric acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2H-benzotriazole;formaldehyde;phosphoric acid?
The IUPAC name of 2H-benzotriazole;formaldehyde;phosphoric acid (CID 172709237) is 2H-benzotriazole;formaldehyde;phosphoric acid.
What is the SMILES notation for 2H-benzotriazole;formaldehyde;phosphoric acid?
The canonical SMILES for 2H-benzotriazole;formaldehyde;phosphoric acid is C=O.O=P(O)(O)O.c1ccc2n[nH]nc2c1.
What is the InChIKey of 2H-benzotriazole;formaldehyde;phosphoric acid?
The InChIKey is FAEIIQYNZQRLQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5N3.CH2O.H3O4P/c1-2-4-6-5(3-1)7-9-8-6;1-2;1-5(2,3)4/h1-4H,(H,7,8,9);1H2;(H3,1,2,3,4).
What are the key properties of 2H-benzotriazole;formaldehyde;phosphoric acid?
2H-benzotriazole;formaldehyde;phosphoric acid has a molecular weight of 247.15 g/mol, XLogP of -0.16, 0 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2H-benzotriazole;formaldehyde;phosphoric acid is sourced from PubChem (CID 172709237), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).