About azane;2H-benzotriazole;phosphorous acid
azane;2H-benzotriazole;phosphorous acid (PubChem CID 175269675) has the molecular formula C6H11N4O3P
and a molecular weight of 218.15 g/mol. Its IUPAC name is azane;2H-benzotriazole;phosphorous acid.
Molecular Properties
| Compound Name | azane;2H-benzotriazole;phosphorous acid |
| PubChem CID | 175269675 |
| Molecular Formula | C6H11N4O3P |
| Molecular Weight | 218.15 g/mol |
| Exact Mass | 218.06 |
| IUPAC Name | azane;2H-benzotriazole;phosphorous acid |
| SMILES | N.OP(O)O.c1ccc2n[nH]nc2c1 |
| InChI | InChI=1S/C6H5N3.H3N.H3O3P/c1-2-4-6-5(3-1)7-9-8-6;;1-4(2)3/h1-4H,(H,7,8,9);1H3;1-3H |
| InChIKey | MMZHHRSJCOZPQE-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 137.26 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.15 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze azane;2H-benzotriazole;phosphorous acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;2H-benzotriazole;phosphorous acid?
The IUPAC name of azane;2H-benzotriazole;phosphorous acid (CID 175269675) is azane;2H-benzotriazole;phosphorous acid.
What is the SMILES notation for azane;2H-benzotriazole;phosphorous acid?
The canonical SMILES for azane;2H-benzotriazole;phosphorous acid is N.OP(O)O.c1ccc2n[nH]nc2c1.
What is the InChIKey of azane;2H-benzotriazole;phosphorous acid?
The InChIKey is MMZHHRSJCOZPQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5N3.H3N.H3O3P/c1-2-4-6-5(3-1)7-9-8-6;;1-4(2)3/h1-4H,(H,7,8,9);1H3;1-3H.
What are the key properties of azane;2H-benzotriazole;phosphorous acid?
azane;2H-benzotriazole;phosphorous acid has a molecular weight of 218.15 g/mol, XLogP of 0.31, 0 rotatable bonds, 5 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for azane;2H-benzotriazole;phosphorous acid is sourced from PubChem (CID 175269675), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).