About 2H-benzotriazole;phenol;prop-2-enylbenzene
2H-benzotriazole;phenol;prop-2-enylbenzene (PubChem CID 175270821) has the molecular formula C21H21N3O
and a molecular weight of 331.42 g/mol. Its IUPAC name is 2H-benzotriazole;phenol;prop-2-enylbenzene.
Molecular Properties
| Compound Name | 2H-benzotriazole;phenol;prop-2-enylbenzene |
| PubChem CID | 175270821 |
| Molecular Formula | C21H21N3O |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.17 |
| IUPAC Name | 2H-benzotriazole;phenol;prop-2-enylbenzene |
| SMILES | C=CCc1ccccc1.Oc1ccccc1.c1ccc2n[nH]nc2c1 |
| InChI | InChI=1S/C9H10.C6H5N3.C6H6O/c1-2-6-9-7-4-3-5-8-9;1-2-4-6-5(3-1)7-9-8-6;7-6-4-2-1-3-5-6/h2-5,7-8H,1,6H2;1-4H,(H,7,8,9);1-5,7H |
| InChIKey | QZFJIONADRMRAY-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2H-benzotriazole;phenol;prop-2-enylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2H-benzotriazole;phenol;prop-2-enylbenzene?
The IUPAC name of 2H-benzotriazole;phenol;prop-2-enylbenzene (CID 175270821) is 2H-benzotriazole;phenol;prop-2-enylbenzene.
What is the SMILES notation for 2H-benzotriazole;phenol;prop-2-enylbenzene?
The canonical SMILES for 2H-benzotriazole;phenol;prop-2-enylbenzene is C=CCc1ccccc1.Oc1ccccc1.c1ccc2n[nH]nc2c1.
What is the InChIKey of 2H-benzotriazole;phenol;prop-2-enylbenzene?
The InChIKey is QZFJIONADRMRAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10.C6H5N3.C6H6O/c1-2-6-9-7-4-3-5-8-9;1-2-4-6-5(3-1)7-9-8-6;7-6-4-2-1-3-5-6/h2-5,7-8H,1,6H2;1-4H,(H,7,8,9);1-5,7H.
What are the key properties of 2H-benzotriazole;phenol;prop-2-enylbenzene?
2H-benzotriazole;phenol;prop-2-enylbenzene has a molecular weight of 331.42 g/mol, XLogP of 4.77, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2H-benzotriazole;phenol;prop-2-enylbenzene is sourced from PubChem (CID 175270821), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).