C23H19N3O3S — CID 71152379
4-[1-oxo-2-(2-quinolin-2-ylethyl)-3H-isoindol-4-yl]thiomorpholine-2,3-dione (PubChem CID 71152379) has the molecular formula C23H19N3O3S and a molecular weight of 417.49 g/mol. Its IUPAC name is 4-[1-oxo-2-(2-quinolin-2-ylethyl)-3H-isoindol-4-yl]thiomorpholine-2,3-dione.
| Compound Name | 4-[1-oxo-2-(2-quinolin-2-ylethyl)-3H-isoindol-4-yl]thiomorpholine-2,3-dione |
|---|---|
| PubChem CID | 71152379 |
| Molecular Formula | C23H19N3O3S |
| Molecular Weight | 417.49 g/mol |
| Exact Mass | 417.11 |
| IUPAC Name | 4-[1-oxo-2-(2-quinolin-2-ylethyl)-3H-isoindol-4-yl]thiomorpholine-2,3-dione |
| SMILES | O=C1SCCN(c2cccc3c2CN(CCc2ccc4ccccc4n2)C3=O)C1=O |
| InChI | InChI=1S/C23H19N3O3S/c27-21-17-5-3-7-20(26-12-13-30-23(29)22(26)28)18(17)14-25(21)11-10-16-9-8-15-4-1-2-6-19(15)24-16/h1-9H,10-14H2 |
| InChIKey | JFDODKMPHHACJZ-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 70.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.49 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|