About 3-[4-[[(1S,5R)-3-propan-2-yl-3-azabicyclo[3.1.0]hexan-6-yl]methoxy]phenyl]quinoline
3-[4-[[(1S,5R)-3-propan-2-yl-3-azabicyclo[3.1.0]hexan-6-yl]methoxy]phenyl]quinoline (PubChem CID 71154306) has the molecular formula C24H26N2O
and a molecular weight of 358.49 g/mol. Its IUPAC name is 3-[4-[[(1S,5R)-3-propan-2-yl-3-azabicyclo[3.1.0]hexan-6-yl]methoxy]phenyl]quinoline.
Molecular Properties
| Compound Name | 3-[4-[[(1S,5R)-3-propan-2-yl-3-azabicyclo[3.1.0]hexan-6-yl]methoxy]phenyl]quinoline |
| PubChem CID | 71154306 |
| Molecular Formula | C24H26N2O |
| Molecular Weight | 358.49 g/mol |
| Exact Mass | 358.20 |
| IUPAC Name | 3-[4-[[(1S,5R)-3-propan-2-yl-3-azabicyclo[3.1.0]hexan-6-yl]methoxy]phenyl]quinoline |
| SMILES | CC(C)N1C[C@@H]2C(COc3ccc(-c4cnc5ccccc5c4)cc3)[C@@H]2C1 |
| InChI | InChI=1S/C24H26N2O/c1-16(2)26-13-21-22(14-26)23(21)15-27-20-9-7-17(8-10-20)19-11-18-5-3-4-6-24(18)25-12-19/h3-12,16,21-23H,13-15H2,1-2H3/t21-,22+,23? |
| InChIKey | BNFFONBFGOQPDP-AIZNXBIQSA-N |
| XLogP | 4.87 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.49 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[4-[[(1S,5R)-3-propan-2-yl-3-azabicyclo[3.1.0]hexan-6-yl]methoxy]phenyl]quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-[[(1S,5R)-3-propan-2-yl-3-azabicyclo[3.1.0]hexan-6-yl]methoxy]phenyl]quinoline?
The IUPAC name of 3-[4-[[(1S,5R)-3-propan-2-yl-3-azabicyclo[3.1.0]hexan-6-yl]methoxy]phenyl]quinoline (CID 71154306) is 3-[4-[[(1S,5R)-3-propan-2-yl-3-azabicyclo[3.1.0]hexan-6-yl]methoxy]phenyl]quinoline.
What is the SMILES notation for 3-[4-[[(1S,5R)-3-propan-2-yl-3-azabicyclo[3.1.0]hexan-6-yl]methoxy]phenyl]quinoline?
The canonical SMILES for 3-[4-[[(1S,5R)-3-propan-2-yl-3-azabicyclo[3.1.0]hexan-6-yl]methoxy]phenyl]quinoline is CC(C)N1C[C@@H]2C(COc3ccc(-c4cnc5ccccc5c4)cc3)[C@@H]2C1.
What is the InChIKey of 3-[4-[[(1S,5R)-3-propan-2-yl-3-azabicyclo[3.1.0]hexan-6-yl]methoxy]phenyl]quinoline?
The InChIKey is BNFFONBFGOQPDP-AIZNXBIQSA-N. The full InChI is InChI=1S/C24H26N2O/c1-16(2)26-13-21-22(14-26)23(21)15-27-20-9-7-17(8-10-20)19-11-18-5-3-4-6-24(18)25-12-19/h3-12,16,21-23H,13-15H2,1-2H3/t21-,22+,23?.
What are the key properties of 3-[4-[[(1S,5R)-3-propan-2-yl-3-azabicyclo[3.1.0]hexan-6-yl]methoxy]phenyl]quinoline?
3-[4-[[(1S,5R)-3-propan-2-yl-3-azabicyclo[3.1.0]hexan-6-yl]methoxy]phenyl]quinoline has a molecular weight of 358.49 g/mol, XLogP of 4.87, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-[[(1S,5R)-3-propan-2-yl-3-azabicyclo[3.1.0]hexan-6-yl]methoxy]phenyl]quinoline is sourced from PubChem (CID 71154306), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).