C21H24N6O3S — CID 71156805
(1R)-1-(2-hydroxyethylamino)-1-[2-(1H-indazol-4-yl)-4-morpholin-4-ylthieno[3,2-d]pyrimidin-6-yl]ethanol (PubChem CID 71156805) has the molecular formula C21H24N6O3S and a molecular weight of 440.53 g/mol. Its IUPAC name is (1R)-1-(2-hydroxyethylamino)-1-[2-(1H-indazol-4-yl)-4-morpholin-4-ylthieno[3,2-d]pyrimidin-6-yl]ethanol.
| Compound Name | (1R)-1-(2-hydroxyethylamino)-1-[2-(1H-indazol-4-yl)-4-morpholin-4-ylthieno[3,2-d]pyrimidin-6-yl]ethanol |
|---|---|
| PubChem CID | 71156805 |
| Molecular Formula | C21H24N6O3S |
| Molecular Weight | 440.53 g/mol |
| Exact Mass | 440.16 |
| IUPAC Name | (1R)-1-(2-hydroxyethylamino)-1-[2-(1H-indazol-4-yl)-4-morpholin-4-ylthieno[3,2-d]pyrimidin-6-yl]ethanol |
| SMILES | C[C@](O)(NCCO)c1cc2nc(-c3cccc4[nH]ncc34)nc(N3CCOCC3)c2s1 |
| InChI | InChI=1S/C21H24N6O3S/c1-21(29,22-5-8-28)17-11-16-18(31-17)20(27-6-9-30-10-7-27)25-19(24-16)13-3-2-4-15-14(13)12-23-26-15/h2-4,11-12,22,28-29H,5-10H2,1H3,(H,23,26)/t21-/m1/s1 |
| InChIKey | LWVUMNXIEAJNDK-OAQYLSRUSA-N |
| XLogP | 1.82 |
| TPSA | 119.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.53 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|