C23H27F2N3O2 — CID 71157882
N-[[(3S)-1-[3-fluoro-4-[4-[(3-fluoropropylamino)methyl]phenyl]phenyl]-5-oxopyrrolidin-3-yl]methyl]acetamide (PubChem CID 71157882) has the molecular formula C23H27F2N3O2 and a molecular weight of 415.48 g/mol. Its IUPAC name is N-[[(3S)-1-[3-fluoro-4-[4-[(3-fluoropropylamino)methyl]phenyl]phenyl]-5-oxopyrrolidin-3-yl]methyl]acetamide.
| Compound Name | N-[[(3S)-1-[3-fluoro-4-[4-[(3-fluoropropylamino)methyl]phenyl]phenyl]-5-oxopyrrolidin-3-yl]methyl]acetamide |
|---|---|
| PubChem CID | 71157882 |
| Molecular Formula | C23H27F2N3O2 |
| Molecular Weight | 415.48 g/mol |
| Exact Mass | 415.21 |
| IUPAC Name | N-[[(3S)-1-[3-fluoro-4-[4-[(3-fluoropropylamino)methyl]phenyl]phenyl]-5-oxopyrrolidin-3-yl]methyl]acetamide |
| SMILES | CC(=O)NC[C@@H]1CC(=O)N(c2ccc(-c3ccc(CNCCCF)cc3)c(F)c2)C1 |
| InChI | InChI=1S/C23H27F2N3O2/c1-16(29)27-14-18-11-23(30)28(15-18)20-7-8-21(22(25)12-20)19-5-3-17(4-6-19)13-26-10-2-9-24/h3-8,12,18,26H,2,9-11,13-15H2,1H3,(H,27,29)/t18-/m0/s1 |
| InChIKey | RCZPJAWFQPBYDQ-SFHVURJKSA-N |
| XLogP | 3.43 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.48 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|