C30H41N5O5 — CID 71158903
3-[[2-[[(2S)-2-(1,3-benzoxazol-2-ylamino)-2-cyclohexylacetyl]-cyclopentylamino]acetyl]amino]-4-cyclobutyl-2-oxobutanamide (PubChem CID 71158903) has the molecular formula C30H41N5O5 and a molecular weight of 551.69 g/mol. Its IUPAC name is 3-[[2-[[(2S)-2-(1,3-benzoxazol-2-ylamino)-2-cyclohexylacetyl]-cyclopentylamino]acetyl]amino]-4-cyclobutyl-2-oxobutanamide.
| Compound Name | 3-[[2-[[(2S)-2-(1,3-benzoxazol-2-ylamino)-2-cyclohexylacetyl]-cyclopentylamino]acetyl]amino]-4-cyclobutyl-2-oxobutanamide |
|---|---|
| PubChem CID | 71158903 |
| Molecular Formula | C30H41N5O5 |
| Molecular Weight | 551.69 g/mol |
| Exact Mass | 551.31 |
| IUPAC Name | 3-[[2-[[(2S)-2-(1,3-benzoxazol-2-ylamino)-2-cyclohexylacetyl]-cyclopentylamino]acetyl]amino]-4-cyclobutyl-2-oxobutanamide |
| SMILES | NC(=O)C(=O)C(CC1CCC1)NC(=O)CN(C(=O)[C@@H](Nc1nc2ccccc2o1)C1CCCCC1)C1CCCC1 |
| InChI | InChI=1S/C30H41N5O5/c31-28(38)27(37)23(17-19-9-8-10-19)32-25(36)18-35(21-13-4-5-14-21)29(39)26(20-11-2-1-3-12-20)34-30-33-22-15-6-7-16-24(22)40-30/h6-7,15-16,19-21,23,26H,1-5,8-14,17-18H2,(H2,31,38)(H,32,36)(H,33,34)/t23?,26-/m0/s1 |
| InChIKey | PUISLPZVTKIWMV-NASUQTAISA-N |
| XLogP | 3.69 |
| TPSA | 147.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.69 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|