C19H19FN4O3 — CID 71159322
N-[4-(2-aminoethoxy)-3-(1H-pyrazol-5-yl)phenyl]-4-fluoro-3-methoxybenzamide (PubChem CID 71159322) has the molecular formula C19H19FN4O3 and a molecular weight of 370.38 g/mol. Its IUPAC name is N-[4-(2-aminoethoxy)-3-(1H-pyrazol-5-yl)phenyl]-4-fluoro-3-methoxybenzamide.
| Compound Name | N-[4-(2-aminoethoxy)-3-(1H-pyrazol-5-yl)phenyl]-4-fluoro-3-methoxybenzamide |
|---|---|
| PubChem CID | 71159322 |
| Molecular Formula | C19H19FN4O3 |
| Molecular Weight | 370.38 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | N-[4-(2-aminoethoxy)-3-(1H-pyrazol-5-yl)phenyl]-4-fluoro-3-methoxybenzamide |
| SMILES | COc1cc(C(=O)Nc2ccc(OCCN)c(-c3ccn[nH]3)c2)ccc1F |
| InChI | InChI=1S/C19H19FN4O3/c1-26-18-10-12(2-4-15(18)20)19(25)23-13-3-5-17(27-9-7-21)14(11-13)16-6-8-22-24-16/h2-6,8,10-11H,7,9,21H2,1H3,(H,22,24)(H,23,25) |
| InChIKey | FBQHFCZOSXQXGB-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 102.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.38 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |