C19H16F4N4O2 — CID 71159323
N-[4-(2-aminoethoxy)-3-(1H-pyrazol-5-yl)phenyl]-3-fluoro-4-(trifluoromethyl)benzamide (PubChem CID 71159323) has the molecular formula C19H16F4N4O2 and a molecular weight of 408.36 g/mol. Its IUPAC name is N-[4-(2-aminoethoxy)-3-(1H-pyrazol-5-yl)phenyl]-3-fluoro-4-(trifluoromethyl)benzamide.
| Compound Name | N-[4-(2-aminoethoxy)-3-(1H-pyrazol-5-yl)phenyl]-3-fluoro-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 71159323 |
| Molecular Formula | C19H16F4N4O2 |
| Molecular Weight | 408.36 g/mol |
| Exact Mass | 408.12 |
| IUPAC Name | N-[4-(2-aminoethoxy)-3-(1H-pyrazol-5-yl)phenyl]-3-fluoro-4-(trifluoromethyl)benzamide |
| SMILES | NCCOc1ccc(NC(=O)c2ccc(C(F)(F)F)c(F)c2)cc1-c1ccn[nH]1 |
| InChI | InChI=1S/C19H16F4N4O2/c20-15-9-11(1-3-14(15)19(21,22)23)18(28)26-12-2-4-17(29-8-6-24)13(10-12)16-5-7-25-27-16/h1-5,7,9-10H,6,8,24H2,(H,25,27)(H,26,28) |
| InChIKey | SGWFYMONVSEMKZ-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 93.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.36 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |