C9H6F4N2O3 — CID 87290765
carbamoyl N-[3-fluoro-4-(trifluoromethyl)phenyl]carbamate (PubChem CID 87290765) has the molecular formula C9H6F4N2O3 and a molecular weight of 266.15 g/mol. Its IUPAC name is carbamoyl N-[3-fluoro-4-(trifluoromethyl)phenyl]carbamate.
| Compound Name | carbamoyl N-[3-fluoro-4-(trifluoromethyl)phenyl]carbamate |
|---|---|
| PubChem CID | 87290765 |
| Molecular Formula | C9H6F4N2O3 |
| Molecular Weight | 266.15 g/mol |
| Exact Mass | 266.03 |
| IUPAC Name | carbamoyl N-[3-fluoro-4-(trifluoromethyl)phenyl]carbamate |
| SMILES | NC(=O)OC(=O)Nc1ccc(C(F)(F)F)c(F)c1 |
| InChI | InChI=1S/C9H6F4N2O3/c10-6-3-4(15-8(17)18-7(14)16)1-2-5(6)9(11,12)13/h1-3H,(H2,14,16)(H,15,17) |
| InChIKey | KCISMSJVAOZSFW-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.15 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|