C20H38N2O4 — CID 71159991
tert-butyl N-[(2R)-2-[[(3R)-3-(2-methoxyethoxy)piperidin-1-yl]methyl]cyclohexyl]carbamate (PubChem CID 71159991) has the molecular formula C20H38N2O4 and a molecular weight of 370.53 g/mol. Its IUPAC name is tert-butyl N-[(2R)-2-[[(3R)-3-(2-methoxyethoxy)piperidin-1-yl]methyl]cyclohexyl]carbamate.
| Compound Name | tert-butyl N-[(2R)-2-[[(3R)-3-(2-methoxyethoxy)piperidin-1-yl]methyl]cyclohexyl]carbamate |
|---|---|
| PubChem CID | 71159991 |
| Molecular Formula | C20H38N2O4 |
| Molecular Weight | 370.53 g/mol |
| Exact Mass | 370.28 |
| IUPAC Name | tert-butyl N-[(2R)-2-[[(3R)-3-(2-methoxyethoxy)piperidin-1-yl]methyl]cyclohexyl]carbamate |
| SMILES | COCCO[C@@H]1CCCN(C[C@H]2CCCCC2NC(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C20H38N2O4/c1-20(2,3)26-19(23)21-18-10-6-5-8-16(18)14-22-11-7-9-17(15-22)25-13-12-24-4/h16-18H,5-15H2,1-4H3,(H,21,23)/t16-,17-,18?/m1/s1 |
| InChIKey | OQFQKJDWXZCZKM-OWZOALSMSA-N |
| XLogP | 3.20 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.53 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|