C8H8F3NO4S2 — CID 71160333
2-(disulfinoamino)-1-methyl-4-(trifluoromethyl)benzene (PubChem CID 71160333) has the molecular formula C8H8F3NO4S2 and a molecular weight of 303.28 g/mol. Its IUPAC name is 2-(disulfinoamino)-1-methyl-4-(trifluoromethyl)benzene.
| Compound Name | 2-(disulfinoamino)-1-methyl-4-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 71160333 |
| Molecular Formula | C8H8F3NO4S2 |
| Molecular Weight | 303.28 g/mol |
| Exact Mass | 302.98 |
| IUPAC Name | 2-(disulfinoamino)-1-methyl-4-(trifluoromethyl)benzene |
| SMILES | Cc1ccc(C(F)(F)F)cc1N(S(=O)O)S(=O)O |
| InChI | InChI=1S/C8H8F3NO4S2/c1-5-2-3-6(8(9,10)11)4-7(5)12(17(13)14)18(15)16/h2-4H,1H3,(H,13,14)(H,15,16) |
| InChIKey | VVRRQLGPGQQPFR-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.28 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|