C21H22N3OP — CID 71165539
N-[(4-methoxyphenyl)methyl]-1-(4-phosphanylcyclohexa-1,5-dien-1-yl)benzimidazol-5-amine (PubChem CID 71165539) has the molecular formula C21H22N3OP and a molecular weight of 363.40 g/mol. Its IUPAC name is N-[(4-methoxyphenyl)methyl]-1-(4-phosphanylcyclohexa-1,5-dien-1-yl)benzimidazol-5-amine.
| Compound Name | N-[(4-methoxyphenyl)methyl]-1-(4-phosphanylcyclohexa-1,5-dien-1-yl)benzimidazol-5-amine |
|---|---|
| PubChem CID | 71165539 |
| Molecular Formula | C21H22N3OP |
| Molecular Weight | 363.40 g/mol |
| Exact Mass | 363.15 |
| IUPAC Name | N-[(4-methoxyphenyl)methyl]-1-(4-phosphanylcyclohexa-1,5-dien-1-yl)benzimidazol-5-amine |
| SMILES | COc1ccc(CNc2ccc3c(c2)ncn3C2=CCC(P)C=C2)cc1 |
| InChI | InChI=1S/C21H22N3OP/c1-25-18-7-2-15(3-8-18)13-22-16-4-11-21-20(12-16)23-14-24(21)17-5-9-19(26)10-6-17/h2-9,11-12,14,19,22H,10,13,26H2,1H3 |
| InChIKey | POAZLYNMKQKNPK-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.40 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_alk_bim(9)', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|