C27H31N5O — CID 66794145
1-(4-methoxyphenyl)-N-[[4-[(4-methylpiperazin-1-yl)methyl]phenyl]methyl]benzimidazol-5-amine (PubChem CID 66794145) has the molecular formula C27H31N5O and a molecular weight of 441.58 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)-N-[[4-[(4-methylpiperazin-1-yl)methyl]phenyl]methyl]benzimidazol-5-amine.
| Compound Name | 1-(4-methoxyphenyl)-N-[[4-[(4-methylpiperazin-1-yl)methyl]phenyl]methyl]benzimidazol-5-amine |
|---|---|
| PubChem CID | 66794145 |
| Molecular Formula | C27H31N5O |
| Molecular Weight | 441.58 g/mol |
| Exact Mass | 441.25 |
| IUPAC Name | 1-(4-methoxyphenyl)-N-[[4-[(4-methylpiperazin-1-yl)methyl]phenyl]methyl]benzimidazol-5-amine |
| SMILES | COc1ccc(-n2cnc3cc(NCc4ccc(CN5CCN(C)CC5)cc4)ccc32)cc1 |
| InChI | InChI=1S/C27H31N5O/c1-30-13-15-31(16-14-30)19-22-5-3-21(4-6-22)18-28-23-7-12-27-26(17-23)29-20-32(27)24-8-10-25(33-2)11-9-24/h3-12,17,20,28H,13-16,18-19H2,1-2H3 |
| InChIKey | DZWCFPPLSDCFPY-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 45.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.58 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_alk_bim(9)', 'substructure': 'N/A'} |
|---|