C25H27N3 — CID 66793952
1-(4-ethylphenyl)-N-[(4-propan-2-ylphenyl)methyl]benzimidazol-5-amine (PubChem CID 66793952) has the molecular formula C25H27N3 and a molecular weight of 369.51 g/mol. Its IUPAC name is 1-(4-ethylphenyl)-N-[(4-propan-2-ylphenyl)methyl]benzimidazol-5-amine.
| Compound Name | 1-(4-ethylphenyl)-N-[(4-propan-2-ylphenyl)methyl]benzimidazol-5-amine |
|---|---|
| PubChem CID | 66793952 |
| Molecular Formula | C25H27N3 |
| Molecular Weight | 369.51 g/mol |
| Exact Mass | 369.22 |
| IUPAC Name | 1-(4-ethylphenyl)-N-[(4-propan-2-ylphenyl)methyl]benzimidazol-5-amine |
| SMILES | CCc1ccc(-n2cnc3cc(NCc4ccc(C(C)C)cc4)ccc32)cc1 |
| InChI | InChI=1S/C25H27N3/c1-4-19-7-12-23(13-8-19)28-17-27-24-15-22(11-14-25(24)28)26-16-20-5-9-21(10-6-20)18(2)3/h5-15,17-18,26H,4,16H2,1-3H3 |
| InChIKey | VLFJKCIARIXLKD-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.51 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_alk_bim(9)', 'substructure': 'N/A'} |
|---|