C18H19ClN6O2 — CID 71166907
3-[1-(aminomethyl)-4-[2-(oxolan-3-ylamino)pyrimidin-4-yl]pyrazol-3-yl]-5-chlorophenol (PubChem CID 71166907) has the molecular formula C18H19ClN6O2 and a molecular weight of 386.84 g/mol. Its IUPAC name is 3-[1-(aminomethyl)-4-[2-(oxolan-3-ylamino)pyrimidin-4-yl]pyrazol-3-yl]-5-chlorophenol.
| Compound Name | 3-[1-(aminomethyl)-4-[2-(oxolan-3-ylamino)pyrimidin-4-yl]pyrazol-3-yl]-5-chlorophenol |
|---|---|
| PubChem CID | 71166907 |
| Molecular Formula | C18H19ClN6O2 |
| Molecular Weight | 386.84 g/mol |
| Exact Mass | 386.13 |
| IUPAC Name | 3-[1-(aminomethyl)-4-[2-(oxolan-3-ylamino)pyrimidin-4-yl]pyrazol-3-yl]-5-chlorophenol |
| SMILES | NCn1cc(-c2ccnc(NC3CCOC3)n2)c(-c2cc(O)cc(Cl)c2)n1 |
| InChI | InChI=1S/C18H19ClN6O2/c19-12-5-11(6-14(26)7-12)17-15(8-25(10-20)24-17)16-1-3-21-18(23-16)22-13-2-4-27-9-13/h1,3,5-8,13,26H,2,4,9-10,20H2,(H,21,22,23) |
| InChIKey | UNZRITGXCDPBRF-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 111.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.84 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |