C24H27NO2 — CID 71169812
4-hexoxy-1-methyl-N-phenylnaphthalene-2-carboxamide (PubChem CID 71169812) has the molecular formula C24H27NO2 and a molecular weight of 361.49 g/mol. Its IUPAC name is 4-hexoxy-1-methyl-N-phenylnaphthalene-2-carboxamide.
| Compound Name | 4-hexoxy-1-methyl-N-phenylnaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 71169812 |
| Molecular Formula | C24H27NO2 |
| Molecular Weight | 361.49 g/mol |
| Exact Mass | 361.20 |
| IUPAC Name | 4-hexoxy-1-methyl-N-phenylnaphthalene-2-carboxamide |
| SMILES | CCCCCCOc1cc(C(=O)Nc2ccccc2)c(C)c2ccccc12 |
| InChI | InChI=1S/C24H27NO2/c1-3-4-5-11-16-27-23-17-22(18(2)20-14-9-10-15-21(20)23)24(26)25-19-12-7-6-8-13-19/h6-10,12-15,17H,3-5,11,16H2,1-2H3,(H,25,26) |
| InChIKey | UXLBXPDPLPPSSR-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.49 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|