C22H21ClN4O — CID 71171374
6-chloro-1-[(4-methylphenyl)methyl]-2-oxo-4-piperazin-1-ylquinoline-3-carbonitrile (PubChem CID 71171374) has the molecular formula C22H21ClN4O and a molecular weight of 392.89 g/mol. Its IUPAC name is 6-chloro-1-[(4-methylphenyl)methyl]-2-oxo-4-piperazin-1-ylquinoline-3-carbonitrile.
| Compound Name | 6-chloro-1-[(4-methylphenyl)methyl]-2-oxo-4-piperazin-1-ylquinoline-3-carbonitrile |
|---|---|
| PubChem CID | 71171374 |
| Molecular Formula | C22H21ClN4O |
| Molecular Weight | 392.89 g/mol |
| Exact Mass | 392.14 |
| IUPAC Name | 6-chloro-1-[(4-methylphenyl)methyl]-2-oxo-4-piperazin-1-ylquinoline-3-carbonitrile |
| SMILES | Cc1ccc(Cn2c(=O)c(C#N)c(N3CCNCC3)c3cc(Cl)ccc32)cc1 |
| InChI | InChI=1S/C22H21ClN4O/c1-15-2-4-16(5-3-15)14-27-20-7-6-17(23)12-18(20)21(19(13-24)22(27)28)26-10-8-25-9-11-26/h2-7,12,25H,8-11,14H2,1H3 |
| InChIKey | DVTCPPLUYPIDIA-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 61.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.89 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |