C19H26ClN3O4 — CID 71171786
tert-butyl 2-(5-chloro-2,4-dimethyl-6-oxo-1H-pyridine-3-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate (PubChem CID 71171786) has the molecular formula C19H26ClN3O4 and a molecular weight of 395.89 g/mol. Its IUPAC name is tert-butyl 2-(5-chloro-2,4-dimethyl-6-oxo-1H-pyridine-3-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate.
| Compound Name | tert-butyl 2-(5-chloro-2,4-dimethyl-6-oxo-1H-pyridine-3-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate |
|---|---|
| PubChem CID | 71171786 |
| Molecular Formula | C19H26ClN3O4 |
| Molecular Weight | 395.89 g/mol |
| Exact Mass | 395.16 |
| IUPAC Name | tert-butyl 2-(5-chloro-2,4-dimethyl-6-oxo-1H-pyridine-3-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate |
| SMILES | Cc1[nH]c(=O)c(Cl)c(C)c1C(=O)N1CC2CN(C(=O)OC(C)(C)C)CC2C1 |
| InChI | InChI=1S/C19H26ClN3O4/c1-10-14(11(2)21-16(24)15(10)20)17(25)22-6-12-8-23(9-13(12)7-22)18(26)27-19(3,4)5/h12-13H,6-9H2,1-5H3,(H,21,24) |
| InChIKey | YHEKEBVCYYVJJG-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 82.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.89 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |