C18H20ClN3O3S — CID 71172557
N-[[(2R)-1-(4-chlorophenyl)sulfonylpiperidin-2-yl]methyl]pyridine-4-carboxamide (PubChem CID 71172557) has the molecular formula C18H20ClN3O3S and a molecular weight of 393.90 g/mol. Its IUPAC name is N-[[(2R)-1-(4-chlorophenyl)sulfonylpiperidin-2-yl]methyl]pyridine-4-carboxamide.
| Compound Name | N-[[(2R)-1-(4-chlorophenyl)sulfonylpiperidin-2-yl]methyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 71172557 |
| Molecular Formula | C18H20ClN3O3S |
| Molecular Weight | 393.90 g/mol |
| Exact Mass | 393.09 |
| IUPAC Name | N-[[(2R)-1-(4-chlorophenyl)sulfonylpiperidin-2-yl]methyl]pyridine-4-carboxamide |
| SMILES | O=C(NC[C@H]1CCCCN1S(=O)(=O)c1ccc(Cl)cc1)c1ccncc1 |
| InChI | InChI=1S/C18H20ClN3O3S/c19-15-4-6-17(7-5-15)26(24,25)22-12-2-1-3-16(22)13-21-18(23)14-8-10-20-11-9-14/h4-11,16H,1-3,12-13H2,(H,21,23)/t16-/m1/s1 |
| InChIKey | MNZJUFQNCJPAGT-MRXNPFEDSA-N |
| XLogP | 2.71 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.90 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |