C38H73N3O2 — CID 71172732
N-[4-[(3R,12S,13R)-3,12-bis(3-aminopropoxy)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentyl]octan-1-amine (PubChem CID 71172732) has the molecular formula C38H73N3O2 and a molecular weight of 604.02 g/mol. Its IUPAC name is N-[4-[(3R,12S,13R)-3,12-bis(3-aminopropoxy)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentyl]octan-1-amine.
| Compound Name | N-[4-[(3R,12S,13R)-3,12-bis(3-aminopropoxy)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentyl]octan-1-amine |
|---|---|
| PubChem CID | 71172732 |
| Molecular Formula | C38H73N3O2 |
| Molecular Weight | 604.02 g/mol |
| Exact Mass | 603.57 |
| IUPAC Name | N-[4-[(3R,12S,13R)-3,12-bis(3-aminopropoxy)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentyl]octan-1-amine |
| SMILES | CCCCCCCCNCCCC(C)C1CCC2C3CCC4C[C@H](OCCCN)CCC4(C)C3C[C@H](OCCCN)[C@]12C |
| InChI | InChI=1S/C38H73N3O2/c1-5-6-7-8-9-10-23-41-24-11-14-29(2)33-17-18-34-32-16-15-30-27-31(42-25-12-21-39)19-20-37(30,3)35(32)28-36(38(33,34)4)43-26-13-22-40/h29-36,41H,5-28,39-40H2,1-4H3/t29?,30?,31-,32?,33?,34?,35?,36+,37?,38-/m1/s1 |
| InChIKey | VOPMJJZKWFDLEC-DNRWZEAMSA-N |
| XLogP | 8.09 |
| TPSA | 82.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.02 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|