C31H59N3O2 — CID 70867879
4-[(3R,12S)-3,12-bis(3-aminopropoxy)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-N-methylpentan-1-amine (PubChem CID 70867879) has the molecular formula C31H59N3O2 and a molecular weight of 505.83 g/mol. Its IUPAC name is 4-[(3R,12S)-3,12-bis(3-aminopropoxy)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-N-methylpentan-1-amine.
| Compound Name | 4-[(3R,12S)-3,12-bis(3-aminopropoxy)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-N-methylpentan-1-amine |
|---|---|
| PubChem CID | 70867879 |
| Molecular Formula | C31H59N3O2 |
| Molecular Weight | 505.83 g/mol |
| Exact Mass | 505.46 |
| IUPAC Name | 4-[(3R,12S)-3,12-bis(3-aminopropoxy)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-N-methylpentan-1-amine |
| SMILES | CNCCCC(C)C1CCC2C3CCC4C[C@H](OCCCN)CCC4(C)C3C[C@H](OCCCN)C12C |
| InChI | InChI=1S/C31H59N3O2/c1-22(8-5-17-34-4)26-11-12-27-25-10-9-23-20-24(35-18-6-15-32)13-14-30(23,2)28(25)21-29(31(26,27)3)36-19-7-16-33/h22-29,34H,5-21,32-33H2,1-4H3/t22?,23?,24-,25?,26?,27?,28?,29+,30?,31?/m1/s1 |
| InChIKey | SFUBLFKTCPRHAH-NEVFUJHOSA-N |
| XLogP | 5.36 |
| TPSA | 82.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.83 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|