C28H53N3O2 — CID 118332495
(4R)-4-[(3R,5R,8R,9S,10S,12S,13R,14S,17R)-3,12-bis(aminomethoxy)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-N,N-dimethylpentan-1-amine (PubChem CID 118332495) has the molecular formula C28H53N3O2 and a molecular weight of 463.75 g/mol. Its IUPAC name is (4R)-4-[(3R,5R,8R,9S,10S,12S,13R,14S,17R)-3,12-bis(aminomethoxy)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-N,N-dimethylpentan-1-amine.
| Compound Name | (4R)-4-[(3R,5R,8R,9S,10S,12S,13R,14S,17R)-3,12-bis(aminomethoxy)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-N,N-dimethylpentan-1-amine |
|---|---|
| PubChem CID | 118332495 |
| Molecular Formula | C28H53N3O2 |
| Molecular Weight | 463.75 g/mol |
| Exact Mass | 463.41 |
| IUPAC Name | (4R)-4-[(3R,5R,8R,9S,10S,12S,13R,14S,17R)-3,12-bis(aminomethoxy)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-N,N-dimethylpentan-1-amine |
| SMILES | C[C@H](CCCN(C)C)[C@H]1CC[C@H]2[C@@H]3CC[C@@H]4C[C@H](OCN)CC[C@]4(C)[C@H]3C[C@H](OCN)[C@]12C |
| InChI | InChI=1S/C28H53N3O2/c1-19(7-6-14-31(4)5)23-10-11-24-22-9-8-20-15-21(32-17-29)12-13-27(20,2)25(22)16-26(33-18-30)28(23,24)3/h19-26H,6-18,29-30H2,1-5H3/t19-,20-,21-,22+,23-,24+,25+,26+,27+,28-/m1/s1 |
| InChIKey | NUWAMVXSKKYUAL-WCQCBKTDSA-N |
| XLogP | 4.84 |
| TPSA | 73.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.75 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|