C17H19N3O2 — CID 71173992
ethyl 7-ethyl-3-(1-methylpyrazol-4-yl)indolizine-2-carboxylate (PubChem CID 71173992) has the molecular formula C17H19N3O2 and a molecular weight of 297.36 g/mol. Its IUPAC name is ethyl 7-ethyl-3-(1-methylpyrazol-4-yl)indolizine-2-carboxylate.
| Compound Name | ethyl 7-ethyl-3-(1-methylpyrazol-4-yl)indolizine-2-carboxylate |
|---|---|
| PubChem CID | 71173992 |
| Molecular Formula | C17H19N3O2 |
| Molecular Weight | 297.36 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | ethyl 7-ethyl-3-(1-methylpyrazol-4-yl)indolizine-2-carboxylate |
| SMILES | CCOC(=O)c1cc2cc(CC)ccn2c1-c1cnn(C)c1 |
| InChI | InChI=1S/C17H19N3O2/c1-4-12-6-7-20-14(8-12)9-15(17(21)22-5-2)16(20)13-10-18-19(3)11-13/h6-11H,4-5H2,1-3H3 |
| InChIKey | LZIXTTIUVQESQQ-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 48.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.36 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |