C22H27NO4 — CID 71175907
1-[(15S)-11-hydroxy-15-methoxy-5-methyl-13-oxa-5-azahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11-trien-16-yl]ethanone (PubChem CID 71175907) has the molecular formula C22H27NO4 and a molecular weight of 369.46 g/mol. Its IUPAC name is 1-[(15S)-11-hydroxy-15-methoxy-5-methyl-13-oxa-5-azahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11-trien-16-yl]ethanone.
| Compound Name | 1-[(15S)-11-hydroxy-15-methoxy-5-methyl-13-oxa-5-azahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11-trien-16-yl]ethanone |
|---|---|
| PubChem CID | 71175907 |
| Molecular Formula | C22H27NO4 |
| Molecular Weight | 369.46 g/mol |
| Exact Mass | 369.19 |
| IUPAC Name | 1-[(15S)-11-hydroxy-15-methoxy-5-methyl-13-oxa-5-azahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11-trien-16-yl]ethanone |
| SMILES | CO[C@@]12CCC3(CC1C(C)=O)C1Cc4ccc(O)c5c4C3(CCN1C)C2O5 |
| InChI | InChI=1S/C22H27NO4/c1-12(24)14-11-20-6-7-22(14,26-3)19-21(20)8-9-23(2)16(20)10-13-4-5-15(25)18(27-19)17(13)21/h4-5,14,16,19,25H,6-11H2,1-3H3/t14?,16?,19?,20?,21?,22-/m0/s1 |
| InChIKey | FORYHHDLYBTHJD-VYTUOFRKSA-N |
| XLogP | 2.43 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.46 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |