C23H29NO4 — CID 118930252
1-[(4R,4aR,6S,7R,7aR,12bS)-4a-ethenyl-9-hydroxy-7-methoxy-3,7-dimethyl-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-6-yl]ethanone (PubChem CID 118930252) has the molecular formula C23H29NO4 and a molecular weight of 383.49 g/mol. Its IUPAC name is 1-[(4R,4aR,6S,7R,7aR,12bS)-4a-ethenyl-9-hydroxy-7-methoxy-3,7-dimethyl-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-6-yl]ethanone.
| Compound Name | 1-[(4R,4aR,6S,7R,7aR,12bS)-4a-ethenyl-9-hydroxy-7-methoxy-3,7-dimethyl-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-6-yl]ethanone |
|---|---|
| PubChem CID | 118930252 |
| Molecular Formula | C23H29NO4 |
| Molecular Weight | 383.49 g/mol |
| Exact Mass | 383.21 |
| IUPAC Name | 1-[(4R,4aR,6S,7R,7aR,12bS)-4a-ethenyl-9-hydroxy-7-methoxy-3,7-dimethyl-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-6-yl]ethanone |
| SMILES | C=C[C@]12C[C@H](C(C)=O)[C@@](C)(OC)[C@@H]3Oc4c(O)ccc5c4[C@@]31CCN(C)[C@@H]2C5 |
| InChI | InChI=1S/C23H29NO4/c1-6-22-12-15(13(2)25)21(3,27-5)20-23(22)9-10-24(4)17(22)11-14-7-8-16(26)19(28-20)18(14)23/h6-8,15,17,20,26H,1,9-12H2,2-5H3/t15-,17-,20+,21-,22-,23+/m1/s1 |
| InChIKey | MSAOJKLULXXIMH-AJGAXXJYSA-N |
| XLogP | 2.84 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.49 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|