C10H16F3N5 — CID 71176960
1-methyl-5-(4-methylpiperazin-1-yl)-3-(trifluoromethyl)pyrazol-4-amine (PubChem CID 71176960) has the molecular formula C10H16F3N5 and a molecular weight of 263.27 g/mol. Its IUPAC name is 1-methyl-5-(4-methylpiperazin-1-yl)-3-(trifluoromethyl)pyrazol-4-amine.
| Compound Name | 1-methyl-5-(4-methylpiperazin-1-yl)-3-(trifluoromethyl)pyrazol-4-amine |
|---|---|
| PubChem CID | 71176960 |
| Molecular Formula | C10H16F3N5 |
| Molecular Weight | 263.27 g/mol |
| Exact Mass | 263.14 |
| IUPAC Name | 1-methyl-5-(4-methylpiperazin-1-yl)-3-(trifluoromethyl)pyrazol-4-amine |
| SMILES | CN1CCN(c2c(N)c(C(F)(F)F)nn2C)CC1 |
| InChI | InChI=1S/C10H16F3N5/c1-16-3-5-18(6-4-16)9-7(14)8(10(11,12)13)15-17(9)2/h3-6,14H2,1-2H3 |
| InChIKey | HCBAGYPBWKTXIU-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 50.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.27 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |