C24H29BrN2O4 — CID 71178623
4-(1,3,4,4a,5,5a,9a,9b-octahydroindeno[1,2-c]pyridin-2-yl)-N-[1-(4-bromophenyl)ethyl]-2,3-dihydroxy-4-oxobutanamide (PubChem CID 71178623) has the molecular formula C24H29BrN2O4 and a molecular weight of 489.41 g/mol. Its IUPAC name is 4-(1,3,4,4a,5,5a,9a,9b-octahydroindeno[1,2-c]pyridin-2-yl)-N-[1-(4-bromophenyl)ethyl]-2,3-dihydroxy-4-oxobutanamide.
| Compound Name | 4-(1,3,4,4a,5,5a,9a,9b-octahydroindeno[1,2-c]pyridin-2-yl)-N-[1-(4-bromophenyl)ethyl]-2,3-dihydroxy-4-oxobutanamide |
|---|---|
| PubChem CID | 71178623 |
| Molecular Formula | C24H29BrN2O4 |
| Molecular Weight | 489.41 g/mol |
| Exact Mass | 488.13 |
| IUPAC Name | 4-(1,3,4,4a,5,5a,9a,9b-octahydroindeno[1,2-c]pyridin-2-yl)-N-[1-(4-bromophenyl)ethyl]-2,3-dihydroxy-4-oxobutanamide |
| SMILES | CC(NC(=O)C(O)C(O)C(=O)N1CCC2CC3C=CC=CC3C2C1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C24H29BrN2O4/c1-14(15-6-8-18(25)9-7-15)26-23(30)21(28)22(29)24(31)27-11-10-17-12-16-4-2-3-5-19(16)20(17)13-27/h2-9,14,16-17,19-22,28-29H,10-13H2,1H3,(H,26,30) |
| InChIKey | OOEGNTMPYKYXCO-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.41 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |