C14H23N7O5 — CID 71178666
2-amino-N-[(2R,4R,5R)-2-[4-(aminodiazenyl)-2-oxopyrimidin-1-yl]-4-hydroxy-5-(hydroxymethyl)oxolan-3-yl]pentanamide (PubChem CID 71178666) has the molecular formula C14H23N7O5 and a molecular weight of 369.38 g/mol. Its IUPAC name is 2-amino-N-[(2R,4R,5R)-2-[4-(aminodiazenyl)-2-oxopyrimidin-1-yl]-4-hydroxy-5-(hydroxymethyl)oxolan-3-yl]pentanamide.
| Compound Name | 2-amino-N-[(2R,4R,5R)-2-[4-(aminodiazenyl)-2-oxopyrimidin-1-yl]-4-hydroxy-5-(hydroxymethyl)oxolan-3-yl]pentanamide |
|---|---|
| PubChem CID | 71178666 |
| Molecular Formula | C14H23N7O5 |
| Molecular Weight | 369.38 g/mol |
| Exact Mass | 369.18 |
| IUPAC Name | 2-amino-N-[(2R,4R,5R)-2-[4-(aminodiazenyl)-2-oxopyrimidin-1-yl]-4-hydroxy-5-(hydroxymethyl)oxolan-3-yl]pentanamide |
| SMILES | CCCC(N)C(=O)NC1[C@@H](O)[C@@H](CO)O[C@H]1n1ccc(/N=N/N)nc1=O |
| InChI | InChI=1S/C14H23N7O5/c1-2-3-7(15)12(24)18-10-11(23)8(6-22)26-13(10)21-5-4-9(19-20-16)17-14(21)25/h4-5,7-8,10-11,13,22-23H,2-3,6,15H2,1H3,(H,18,24)(H2,16,17,19,25)/t7?,8-,10?,11+,13-/m1/s1 |
| InChIKey | OYKRZURPCWLRFS-DKXYZANUSA-N |
| XLogP | -1.94 |
| TPSA | 190.44 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.38 |
| LogP ≤ 5 | -1.94 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|