C15H26N6O5 — CID 22899181
(2S)-2,6-diamino-N-[(2R,3R,4S,5R)-2-(4-amino-2-oxopyrimidin-1-yl)-4-hydroxy-5-(hydroxymethyl)oxolan-3-yl]hexanamide (PubChem CID 22899181) has the molecular formula C15H26N6O5 and a molecular weight of 370.41 g/mol. Its IUPAC name is (2S)-2,6-diamino-N-[(2R,3R,4S,5R)-2-(4-amino-2-oxopyrimidin-1-yl)-4-hydroxy-5-(hydroxymethyl)oxolan-3-yl]hexanamide.
| Compound Name | (2S)-2,6-diamino-N-[(2R,3R,4S,5R)-2-(4-amino-2-oxopyrimidin-1-yl)-4-hydroxy-5-(hydroxymethyl)oxolan-3-yl]hexanamide |
|---|---|
| PubChem CID | 22899181 |
| Molecular Formula | C15H26N6O5 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.20 |
| IUPAC Name | (2S)-2,6-diamino-N-[(2R,3R,4S,5R)-2-(4-amino-2-oxopyrimidin-1-yl)-4-hydroxy-5-(hydroxymethyl)oxolan-3-yl]hexanamide |
| SMILES | NCCCC[C@H](N)C(=O)N[C@@H]1[C@H](O)[C@@H](CO)O[C@H]1n1ccc(N)nc1=O |
| InChI | InChI=1S/C15H26N6O5/c16-5-2-1-3-8(17)13(24)20-11-12(23)9(7-22)26-14(11)21-6-4-10(18)19-15(21)25/h4,6,8-9,11-12,14,22-23H,1-3,5,7,16-17H2,(H,20,24)(H2,18,19,25)/t8-,9+,11+,12+,14+/m0/s1 |
| InChIKey | MCZKLAWWMDRLAV-XKYXEJCGSA-N |
| XLogP | -2.98 |
| TPSA | 191.74 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | -2.98 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|