C27H26N6O2S — CID 71179512
4-[[8-amino-1-(2-phenylquinolin-7-yl)imidazo[1,5-a]pyrazin-3-yl]methyl]piperidine-1-sulfinic acid (PubChem CID 71179512) has the molecular formula C27H26N6O2S and a molecular weight of 498.61 g/mol. Its IUPAC name is 4-[[8-amino-1-(2-phenylquinolin-7-yl)imidazo[1,5-a]pyrazin-3-yl]methyl]piperidine-1-sulfinic acid.
| Compound Name | 4-[[8-amino-1-(2-phenylquinolin-7-yl)imidazo[1,5-a]pyrazin-3-yl]methyl]piperidine-1-sulfinic acid |
|---|---|
| PubChem CID | 71179512 |
| Molecular Formula | C27H26N6O2S |
| Molecular Weight | 498.61 g/mol |
| Exact Mass | 498.18 |
| IUPAC Name | 4-[[8-amino-1-(2-phenylquinolin-7-yl)imidazo[1,5-a]pyrazin-3-yl]methyl]piperidine-1-sulfinic acid |
| SMILES | Nc1nccn2c(CC3CCN(S(=O)O)CC3)nc(-c3ccc4ccc(-c5ccccc5)nc4c3)c12 |
| InChI | InChI=1S/C27H26N6O2S/c28-27-26-25(21-7-6-20-8-9-22(30-23(20)17-21)19-4-2-1-3-5-19)31-24(33(26)15-12-29-27)16-18-10-13-32(14-11-18)36(34)35/h1-9,12,15,17-18H,10-11,13-14,16H2,(H2,28,29)(H,34,35) |
| InChIKey | YXNPUQZBGYQNPO-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 109.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.61 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|