C12H13ClN2O2 — CID 71181940
methyl 2-amino-2-(2-chlorophenyl)-4-cyanobutanoate (PubChem CID 71181940) has the molecular formula C12H13ClN2O2 and a molecular weight of 252.70 g/mol. Its IUPAC name is methyl 2-amino-2-(2-chlorophenyl)-4-cyanobutanoate.
| Compound Name | methyl 2-amino-2-(2-chlorophenyl)-4-cyanobutanoate |
|---|---|
| PubChem CID | 71181940 |
| Molecular Formula | C12H13ClN2O2 |
| Molecular Weight | 252.70 g/mol |
| Exact Mass | 252.07 |
| IUPAC Name | methyl 2-amino-2-(2-chlorophenyl)-4-cyanobutanoate |
| SMILES | COC(=O)C(N)(CCC#N)c1ccccc1Cl |
| InChI | InChI=1S/C12H13ClN2O2/c1-17-11(16)12(15,7-4-8-14)9-5-2-3-6-10(9)13/h2-3,5-6H,4,7,15H2,1H3 |
| InChIKey | ZVKYHIXSSULYKH-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 76.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.70 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |