C16H18ClNO4 — CID 70510558
4-(2-chlorophenyl)-4-cyano-7-methoxy-6-methyl-7-oxoheptanoic acid (PubChem CID 70510558) has the molecular formula C16H18ClNO4 and a molecular weight of 323.78 g/mol. Its IUPAC name is 4-(2-chlorophenyl)-4-cyano-7-methoxy-6-methyl-7-oxoheptanoic acid.
| Compound Name | 4-(2-chlorophenyl)-4-cyano-7-methoxy-6-methyl-7-oxoheptanoic acid |
|---|---|
| PubChem CID | 70510558 |
| Molecular Formula | C16H18ClNO4 |
| Molecular Weight | 323.78 g/mol |
| Exact Mass | 323.09 |
| IUPAC Name | 4-(2-chlorophenyl)-4-cyano-7-methoxy-6-methyl-7-oxoheptanoic acid |
| SMILES | COC(=O)C(C)CC(C#N)(CCC(=O)O)c1ccccc1Cl |
| InChI | InChI=1S/C16H18ClNO4/c1-11(15(21)22-2)9-16(10-18,8-7-14(19)20)12-5-3-4-6-13(12)17/h3-6,11H,7-9H2,1-2H3,(H,19,20) |
| InChIKey | CGMPXTWBWKXHRK-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 87.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.78 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |