C22H18N2O2S2 — CID 71186149
5,8-bis[(4-methoxyphenyl)sulfanyl]phthalazine (PubChem CID 71186149) has the molecular formula C22H18N2O2S2 and a molecular weight of 406.53 g/mol. Its IUPAC name is 5,8-bis[(4-methoxyphenyl)sulfanyl]phthalazine.
| Compound Name | 5,8-bis[(4-methoxyphenyl)sulfanyl]phthalazine |
|---|---|
| PubChem CID | 71186149 |
| Molecular Formula | C22H18N2O2S2 |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.08 |
| IUPAC Name | 5,8-bis[(4-methoxyphenyl)sulfanyl]phthalazine |
| SMILES | COc1ccc(Sc2ccc(Sc3ccc(OC)cc3)c3cnncc23)cc1 |
| InChI | InChI=1S/C22H18N2O2S2/c1-25-15-3-7-17(8-4-15)27-21-11-12-22(20-14-24-23-13-19(20)21)28-18-9-5-16(26-2)6-10-18/h3-14H,1-2H3 |
| InChIKey | ZYQYFTMEOCNASE-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |